C6H4Cl3N3O2 — CID 79173591
4-chloro-1-(2,3-dichloroprop-2-enyl)-3-nitropyrazole (PubChem CID 79173591) has the molecular formula C6H4Cl3N3O2 and a molecular weight of 256.48 g/mol. Its IUPAC name is 4-chloro-1-(2,3-dichloroprop-2-enyl)-3-nitropyrazole.
| Compound Name | 4-chloro-1-(2,3-dichloroprop-2-enyl)-3-nitropyrazole |
|---|---|
| PubChem CID | 79173591 |
| Molecular Formula | C6H4Cl3N3O2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 254.94 |
| IUPAC Name | 4-chloro-1-(2,3-dichloroprop-2-enyl)-3-nitropyrazole |
| SMILES | O=[N+]([O-])c1nn(CC(Cl)=CCl)cc1Cl |
| InChI | InChI=1S/C6H4Cl3N3O2/c7-1-4(8)2-11-3-5(9)6(10-11)12(13)14/h1,3H,2H2 |
| InChIKey | XLINJUIENFJOBP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|