C12H17N3O4 — CID 79173918
2-[(4-methyl-5-nitro-2-pyridinyl)amino]hexanoic acid (PubChem CID 79173918) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-[(4-methyl-5-nitro-2-pyridinyl)amino]hexanoic acid.
| Compound Name | 2-[(4-methyl-5-nitro-2-pyridinyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 79173918 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-[(4-methyl-5-nitro-2-pyridinyl)amino]hexanoic acid |
| SMILES | CCCCC(Nc1cc(C)c([N+](=O)[O-])cn1)C(=O)O |
| InChI | InChI=1S/C12H17N3O4/c1-3-4-5-9(12(16)17)14-11-6-8(2)10(7-13-11)15(18)19/h6-7,9H,3-5H2,1-2H3,(H,13,14)(H,16,17) |
| InChIKey | ODEDCJLLRWBXQM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|