C14H27N3S — CID 79174883
2,2-dimethyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)butanethioamide (PubChem CID 79174883) has the molecular formula C14H27N3S and a molecular weight of 269.46 g/mol. Its IUPAC name is 2,2-dimethyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)butanethioamide.
| Compound Name | 2,2-dimethyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)butanethioamide |
|---|---|
| PubChem CID | 79174883 |
| Molecular Formula | C14H27N3S |
| Molecular Weight | 269.46 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 2,2-dimethyl-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)butanethioamide |
| SMILES | CN1C2CCC1CN(CCC(C)(C)C(N)=S)CC2 |
| InChI | InChI=1S/C14H27N3S/c1-14(2,13(15)18)7-9-17-8-6-11-4-5-12(10-17)16(11)3/h11-12H,4-10H2,1-3H3,(H2,15,18) |
| InChIKey | SFAMMLFDQMURIV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|