About [2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol
[2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol (PubChem CID 79175516) has the molecular formula C15H22N2O
and a molecular weight of 246.35 g/mol. Its IUPAC name is [2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol |
| PubChem CID | 79175516 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | [2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol |
| SMILES | CN1C2CCC1CN(c1ccccc1CO)CC2 |
| InChI | InChI=1S/C15H22N2O/c1-16-13-6-7-14(16)10-17(9-8-13)15-5-3-2-4-12(15)11-18/h2-5,13-14,18H,6-11H2,1H3 |
| InChIKey | DVFNOPQCNDPRLR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol?
The IUPAC name of [2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol (CID 79175516) is [2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol.
What is the SMILES notation for [2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol?
The canonical SMILES for [2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol is CN1C2CCC1CN(c1ccccc1CO)CC2.
What is the InChIKey of [2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol?
The InChIKey is DVFNOPQCNDPRLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O/c1-16-13-6-7-14(16)10-17(9-8-13)15-5-3-2-4-12(15)11-18/h2-5,13-14,18H,6-11H2,1H3.
What are the key properties of [2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol?
[2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol has a molecular weight of 246.35 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)phenyl]methanol is sourced from PubChem (CID 79175516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).