About N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine
N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine (PubChem CID 79175631) has the molecular formula C13H19BrN4O2
and a molecular weight of 343.23 g/mol. Its IUPAC name is N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine.
Molecular Properties
| Compound Name | N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine |
| PubChem CID | 79175631 |
| Molecular Formula | C13H19BrN4O2 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine |
| SMILES | COCCOCCCNCc1cnc2cnc(Br)cn12 |
| InChI | InChI=1S/C13H19BrN4O2/c1-19-5-6-20-4-2-3-15-7-11-8-17-13-9-16-12(14)10-18(11)13/h8-10,15H,2-7H2,1H3 |
| InChIKey | BUIGWIWITVEKPH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine?
The IUPAC name of N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine (CID 79175631) is N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine.
What is the SMILES notation for N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine?
The canonical SMILES for N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine is COCCOCCCNCc1cnc2cnc(Br)cn12.
What is the InChIKey of N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine?
The InChIKey is BUIGWIWITVEKPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BrN4O2/c1-19-5-6-20-4-2-3-15-7-11-8-17-13-9-16-12(14)10-18(11)13/h8-10,15H,2-7H2,1H3.
What are the key properties of N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine?
N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine has a molecular weight of 343.23 g/mol, XLogP of 1.63, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine is sourced from PubChem (CID 79175631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).