C14H17ClFNO3S — CID 79177253
4-[4-(chloromethyl)-2-fluorophenyl]sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 79177253) has the molecular formula C14H17ClFNO3S and a molecular weight of 333.81 g/mol. Its IUPAC name is 4-[4-(chloromethyl)-2-fluorophenyl]sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | 4-[4-(chloromethyl)-2-fluorophenyl]sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 79177253 |
| Molecular Formula | C14H17ClFNO3S |
| Molecular Weight | 333.81 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 4-[4-(chloromethyl)-2-fluorophenyl]sulfonyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | O=S(=O)(c1ccc(CCl)cc1F)N1CCOC2CCCC21 |
| InChI | InChI=1S/C14H17ClFNO3S/c15-9-10-4-5-14(11(16)8-10)21(18,19)17-6-7-20-13-3-1-2-12(13)17/h4-5,8,12-13H,1-3,6-7,9H2 |
| InChIKey | YDQIHMWYBHTGOD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.81 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|