About 6-methoxy-N,2-dimethylhex-1-en-3-amine
6-methoxy-N,2-dimethylhex-1-en-3-amine (PubChem CID 79177287) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is 6-methoxy-N,2-dimethylhex-1-en-3-amine.
Molecular Properties
| Compound Name | 6-methoxy-N,2-dimethylhex-1-en-3-amine |
| PubChem CID | 79177287 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 6-methoxy-N,2-dimethylhex-1-en-3-amine |
| SMILES | C=C(C)C(CCCOC)NC |
| InChI | InChI=1S/C9H19NO/c1-8(2)9(10-3)6-5-7-11-4/h9-10H,1,5-7H2,2-4H3 |
| InChIKey | XBTOPZVPZPUXQP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-N,2-dimethylhex-1-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-N,2-dimethylhex-1-en-3-amine?
The IUPAC name of 6-methoxy-N,2-dimethylhex-1-en-3-amine (CID 79177287) is 6-methoxy-N,2-dimethylhex-1-en-3-amine.
What is the SMILES notation for 6-methoxy-N,2-dimethylhex-1-en-3-amine?
The canonical SMILES for 6-methoxy-N,2-dimethylhex-1-en-3-amine is C=C(C)C(CCCOC)NC.
What is the InChIKey of 6-methoxy-N,2-dimethylhex-1-en-3-amine?
The InChIKey is XBTOPZVPZPUXQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO/c1-8(2)9(10-3)6-5-7-11-4/h9-10H,1,5-7H2,2-4H3.
What are the key properties of 6-methoxy-N,2-dimethylhex-1-en-3-amine?
6-methoxy-N,2-dimethylhex-1-en-3-amine has a molecular weight of 157.26 g/mol, XLogP of 1.58, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-N,2-dimethylhex-1-en-3-amine is sourced from PubChem (CID 79177287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).