C12H26N2 — CID 79177761
3-ethyl-3-N,3-N,6-trimethylhept-5-ene-3,4-diamine (PubChem CID 79177761) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is 3-ethyl-3-N,3-N,6-trimethylhept-5-ene-3,4-diamine.
| Compound Name | 3-ethyl-3-N,3-N,6-trimethylhept-5-ene-3,4-diamine |
|---|---|
| PubChem CID | 79177761 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 3-ethyl-3-N,3-N,6-trimethylhept-5-ene-3,4-diamine |
| SMILES | CCC(CC)(C(N)C=C(C)C)N(C)C |
| InChI | InChI=1S/C12H26N2/c1-7-12(8-2,14(5)6)11(13)9-10(3)4/h9,11H,7-8,13H2,1-6H3 |
| InChIKey | XQMCIMDHOCCERP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|