C9H20N2 — CID 79177992
1-N,1-N,2-N,4-tetramethylpent-3-ene-1,2-diamine (PubChem CID 79177992) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is 1-N,1-N,2-N,4-tetramethylpent-3-ene-1,2-diamine.
| Compound Name | 1-N,1-N,2-N,4-tetramethylpent-3-ene-1,2-diamine |
|---|---|
| PubChem CID | 79177992 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 1-N,1-N,2-N,4-tetramethylpent-3-ene-1,2-diamine |
| SMILES | CNC(C=C(C)C)CN(C)C |
| InChI | InChI=1S/C9H20N2/c1-8(2)6-9(10-3)7-11(4)5/h6,9-10H,7H2,1-5H3 |
| InChIKey | WPETUTZAFCKYGB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|