About 2-(diethylamino)-2,5-dimethylhex-5-en-3-ol
2-(diethylamino)-2,5-dimethylhex-5-en-3-ol (PubChem CID 79178034) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 2-(diethylamino)-2,5-dimethylhex-5-en-3-ol.
Molecular Properties
| Compound Name | 2-(diethylamino)-2,5-dimethylhex-5-en-3-ol |
| PubChem CID | 79178034 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 2-(diethylamino)-2,5-dimethylhex-5-en-3-ol |
| SMILES | C=C(C)CC(O)C(C)(C)N(CC)CC |
| InChI | InChI=1S/C12H25NO/c1-7-13(8-2)12(5,6)11(14)9-10(3)4/h11,14H,3,7-9H2,1-2,4-6H3 |
| InChIKey | UBKDVPKIXFTYQD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)-2,5-dimethylhex-5-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)-2,5-dimethylhex-5-en-3-ol?
The IUPAC name of 2-(diethylamino)-2,5-dimethylhex-5-en-3-ol (CID 79178034) is 2-(diethylamino)-2,5-dimethylhex-5-en-3-ol.
What is the SMILES notation for 2-(diethylamino)-2,5-dimethylhex-5-en-3-ol?
The canonical SMILES for 2-(diethylamino)-2,5-dimethylhex-5-en-3-ol is C=C(C)CC(O)C(C)(C)N(CC)CC.
What is the InChIKey of 2-(diethylamino)-2,5-dimethylhex-5-en-3-ol?
The InChIKey is UBKDVPKIXFTYQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-7-13(8-2)12(5,6)11(14)9-10(3)4/h11,14H,3,7-9H2,1-2,4-6H3.
What are the key properties of 2-(diethylamino)-2,5-dimethylhex-5-en-3-ol?
2-(diethylamino)-2,5-dimethylhex-5-en-3-ol has a molecular weight of 199.34 g/mol, XLogP of 2.43, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)-2,5-dimethylhex-5-en-3-ol is sourced from PubChem (CID 79178034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).