C15H18N2O4 — CID 79178738
1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]-3,4-dimethylpyrrolidine-2,5-dione (PubChem CID 79178738) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]-3,4-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]-3,4-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 79178738 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-[(6-amino-4H-1,3-benzodioxin-8-yl)methyl]-3,4-dimethylpyrrolidine-2,5-dione |
| SMILES | CC1C(=O)N(Cc2cc(N)cc3c2OCOC3)C(=O)C1C |
| InChI | InChI=1S/C15H18N2O4/c1-8-9(2)15(19)17(14(8)18)5-10-3-12(16)4-11-6-20-7-21-13(10)11/h3-4,8-9H,5-7,16H2,1-2H3 |
| InChIKey | JWPZAIGRHDJMLN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|