C13H18FN — CID 79179136
1-(4-fluorophenyl)-N,4-dimethylpent-4-en-2-amine (PubChem CID 79179136) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N,4-dimethylpent-4-en-2-amine.
| Compound Name | 1-(4-fluorophenyl)-N,4-dimethylpent-4-en-2-amine |
|---|---|
| PubChem CID | 79179136 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 1-(4-fluorophenyl)-N,4-dimethylpent-4-en-2-amine |
| SMILES | C=C(C)CC(Cc1ccc(F)cc1)NC |
| InChI | InChI=1S/C13H18FN/c1-10(2)8-13(15-3)9-11-4-6-12(14)7-5-11/h4-7,13,15H,1,8-9H2,2-3H3 |
| InChIKey | KBQSEUVXAVEAMD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|