C14H19FN2O3S — CID 79179649
[4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylsulfonyl)-3-fluorophenyl]methanamine (PubChem CID 79179649) has the molecular formula C14H19FN2O3S and a molecular weight of 314.38 g/mol. Its IUPAC name is [4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylsulfonyl)-3-fluorophenyl]methanamine.
| Compound Name | [4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylsulfonyl)-3-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 79179649 |
| Molecular Formula | C14H19FN2O3S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylsulfonyl)-3-fluorophenyl]methanamine |
| SMILES | NCc1ccc(S(=O)(=O)N2CCOC3CCCC32)c(F)c1 |
| InChI | InChI=1S/C14H19FN2O3S/c15-11-8-10(9-16)4-5-14(11)21(18,19)17-6-7-20-13-3-1-2-12(13)17/h4-5,8,12-13H,1-3,6-7,9,16H2 |
| InChIKey | YZTNYNZJTGKGQW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |