C13H28N2 — CID 79179939
1-N,1-N,3-N-triethyl-5-methylhex-4-ene-1,3-diamine (PubChem CID 79179939) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 1-N,1-N,3-N-triethyl-5-methylhex-4-ene-1,3-diamine.
| Compound Name | 1-N,1-N,3-N-triethyl-5-methylhex-4-ene-1,3-diamine |
|---|---|
| PubChem CID | 79179939 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 1-N,1-N,3-N-triethyl-5-methylhex-4-ene-1,3-diamine |
| SMILES | CCNC(C=C(C)C)CCN(CC)CC |
| InChI | InChI=1S/C13H28N2/c1-6-14-13(11-12(4)5)9-10-15(7-2)8-3/h11,13-14H,6-10H2,1-5H3 |
| InChIKey | VMBUVIIRUMLGEG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|