About 5-(tert-butylamino)-2,3-dimethylpent-1-en-3-ol
5-(tert-butylamino)-2,3-dimethylpent-1-en-3-ol (PubChem CID 79180136) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is 5-(tert-butylamino)-2,3-dimethylpent-1-en-3-ol.
Molecular Properties
| Compound Name | 5-(tert-butylamino)-2,3-dimethylpent-1-en-3-ol |
| PubChem CID | 79180136 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 5-(tert-butylamino)-2,3-dimethylpent-1-en-3-ol |
| SMILES | C=C(C)C(C)(O)CCNC(C)(C)C |
| InChI | InChI=1S/C11H23NO/c1-9(2)11(6,13)7-8-12-10(3,4)5/h12-13H,1,7-8H2,2-6H3 |
| InChIKey | VFILEMDVQGIYDQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(tert-butylamino)-2,3-dimethylpent-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(tert-butylamino)-2,3-dimethylpent-1-en-3-ol?
The IUPAC name of 5-(tert-butylamino)-2,3-dimethylpent-1-en-3-ol (CID 79180136) is 5-(tert-butylamino)-2,3-dimethylpent-1-en-3-ol.
What is the SMILES notation for 5-(tert-butylamino)-2,3-dimethylpent-1-en-3-ol?
The canonical SMILES for 5-(tert-butylamino)-2,3-dimethylpent-1-en-3-ol is C=C(C)C(C)(O)CCNC(C)(C)C.
What is the InChIKey of 5-(tert-butylamino)-2,3-dimethylpent-1-en-3-ol?
The InChIKey is VFILEMDVQGIYDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO/c1-9(2)11(6,13)7-8-12-10(3,4)5/h12-13H,1,7-8H2,2-6H3.
What are the key properties of 5-(tert-butylamino)-2,3-dimethylpent-1-en-3-ol?
5-(tert-butylamino)-2,3-dimethylpent-1-en-3-ol has a molecular weight of 185.31 g/mol, XLogP of 2.09, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(tert-butylamino)-2,3-dimethylpent-1-en-3-ol is sourced from PubChem (CID 79180136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).