C11H14ClN3O2 — CID 79180812
6-chloro-2-(3,4-dimethylpyrrolidin-1-yl)-3-nitropyridine (PubChem CID 79180812) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. Its IUPAC name is 6-chloro-2-(3,4-dimethylpyrrolidin-1-yl)-3-nitropyridine.
| Compound Name | 6-chloro-2-(3,4-dimethylpyrrolidin-1-yl)-3-nitropyridine |
|---|---|
| PubChem CID | 79180812 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 6-chloro-2-(3,4-dimethylpyrrolidin-1-yl)-3-nitropyridine |
| SMILES | CC1CN(c2nc(Cl)ccc2[N+](=O)[O-])CC1C |
| InChI | InChI=1S/C11H14ClN3O2/c1-7-5-14(6-8(7)2)11-9(15(16)17)3-4-10(12)13-11/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | MHZMWORGBHURPA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|