About (2-amino-1,3-benzothiazol-6-yl)-(3,4-dimethylpyrrolidin-1-yl)methanone
(2-amino-1,3-benzothiazol-6-yl)-(3,4-dimethylpyrrolidin-1-yl)methanone (PubChem CID 79180940) has the molecular formula C14H17N3OS
and a molecular weight of 275.38 g/mol. Its IUPAC name is (2-amino-1,3-benzothiazol-6-yl)-(3,4-dimethylpyrrolidin-1-yl)methanone.
Molecular Properties
| Compound Name | (2-amino-1,3-benzothiazol-6-yl)-(3,4-dimethylpyrrolidin-1-yl)methanone |
| PubChem CID | 79180940 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | (2-amino-1,3-benzothiazol-6-yl)-(3,4-dimethylpyrrolidin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccc3nc(N)sc3c2)CC1C |
| InChI | InChI=1S/C14H17N3OS/c1-8-6-17(7-9(8)2)13(18)10-3-4-11-12(5-10)19-14(15)16-11/h3-5,8-9H,6-7H2,1-2H3,(H2,15,16) |
| InChIKey | YZGVIVUKIKOSIB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-amino-1,3-benzothiazol-6-yl)-(3,4-dimethylpyrrolidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-1,3-benzothiazol-6-yl)-(3,4-dimethylpyrrolidin-1-yl)methanone?
The IUPAC name of (2-amino-1,3-benzothiazol-6-yl)-(3,4-dimethylpyrrolidin-1-yl)methanone (CID 79180940) is (2-amino-1,3-benzothiazol-6-yl)-(3,4-dimethylpyrrolidin-1-yl)methanone.
What is the SMILES notation for (2-amino-1,3-benzothiazol-6-yl)-(3,4-dimethylpyrrolidin-1-yl)methanone?
The canonical SMILES for (2-amino-1,3-benzothiazol-6-yl)-(3,4-dimethylpyrrolidin-1-yl)methanone is CC1CN(C(=O)c2ccc3nc(N)sc3c2)CC1C.
What is the InChIKey of (2-amino-1,3-benzothiazol-6-yl)-(3,4-dimethylpyrrolidin-1-yl)methanone?
The InChIKey is YZGVIVUKIKOSIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3OS/c1-8-6-17(7-9(8)2)13(18)10-3-4-11-12(5-10)19-14(15)16-11/h3-5,8-9H,6-7H2,1-2H3,(H2,15,16).
What are the key properties of (2-amino-1,3-benzothiazol-6-yl)-(3,4-dimethylpyrrolidin-1-yl)methanone?
(2-amino-1,3-benzothiazol-6-yl)-(3,4-dimethylpyrrolidin-1-yl)methanone has a molecular weight of 275.38 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-1,3-benzothiazol-6-yl)-(3,4-dimethylpyrrolidin-1-yl)methanone is sourced from PubChem (CID 79180940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).