About [5-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine
[5-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine (PubChem CID 79181055) has the molecular formula C10H17N5O2S
and a molecular weight of 271.35 g/mol. Its IUPAC name is [5-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine.
Molecular Properties
| Compound Name | [5-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine |
| PubChem CID | 79181055 |
| Molecular Formula | C10H17N5O2S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | [5-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine |
| SMILES | CC1CN(S(=O)(=O)c2cnc(NN)nc2)CC1C |
| InChI | InChI=1S/C10H17N5O2S/c1-7-5-15(6-8(7)2)18(16,17)9-3-12-10(14-11)13-4-9/h3-4,7-8H,5-6,11H2,1-2H3,(H,12,13,14) |
| InChIKey | PHEMWVQKCAOART-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine?
The IUPAC name of [5-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine (CID 79181055) is [5-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine.
What is the SMILES notation for [5-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine?
The canonical SMILES for [5-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine is CC1CN(S(=O)(=O)c2cnc(NN)nc2)CC1C.
What is the InChIKey of [5-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine?
The InChIKey is PHEMWVQKCAOART-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5O2S/c1-7-5-15(6-8(7)2)18(16,17)9-3-12-10(14-11)13-4-9/h3-4,7-8H,5-6,11H2,1-2H3,(H,12,13,14).
What are the key properties of [5-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine?
[5-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine has a molecular weight of 271.35 g/mol, XLogP of 0.04, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine is sourced from PubChem (CID 79181055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).