About 1-(5-hydroxyhexyl)-3,4-dimethylpyrrolidine-2,5-dione
1-(5-hydroxyhexyl)-3,4-dimethylpyrrolidine-2,5-dione (PubChem CID 79181459) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is 1-(5-hydroxyhexyl)-3,4-dimethylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 1-(5-hydroxyhexyl)-3,4-dimethylpyrrolidine-2,5-dione |
| PubChem CID | 79181459 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 1-(5-hydroxyhexyl)-3,4-dimethylpyrrolidine-2,5-dione |
| SMILES | CC(O)CCCCN1C(=O)C(C)C(C)C1=O |
| InChI | InChI=1S/C12H21NO3/c1-8(14)6-4-5-7-13-11(15)9(2)10(3)12(13)16/h8-10,14H,4-7H2,1-3H3 |
| InChIKey | JANNORCDRYYXEW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-hydroxyhexyl)-3,4-dimethylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-hydroxyhexyl)-3,4-dimethylpyrrolidine-2,5-dione?
The IUPAC name of 1-(5-hydroxyhexyl)-3,4-dimethylpyrrolidine-2,5-dione (CID 79181459) is 1-(5-hydroxyhexyl)-3,4-dimethylpyrrolidine-2,5-dione.
What is the SMILES notation for 1-(5-hydroxyhexyl)-3,4-dimethylpyrrolidine-2,5-dione?
The canonical SMILES for 1-(5-hydroxyhexyl)-3,4-dimethylpyrrolidine-2,5-dione is CC(O)CCCCN1C(=O)C(C)C(C)C1=O.
What is the InChIKey of 1-(5-hydroxyhexyl)-3,4-dimethylpyrrolidine-2,5-dione?
The InChIKey is JANNORCDRYYXEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c1-8(14)6-4-5-7-13-11(15)9(2)10(3)12(13)16/h8-10,14H,4-7H2,1-3H3.
What are the key properties of 1-(5-hydroxyhexyl)-3,4-dimethylpyrrolidine-2,5-dione?
1-(5-hydroxyhexyl)-3,4-dimethylpyrrolidine-2,5-dione has a molecular weight of 227.30 g/mol, XLogP of 1.18, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-hydroxyhexyl)-3,4-dimethylpyrrolidine-2,5-dione is sourced from PubChem (CID 79181459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).