C15H21N3O2 — CID 79181550
3,4-dimethyl-1-[[2-(propylamino)-3-pyridinyl]methyl]pyrrolidine-2,5-dione (PubChem CID 79181550) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3,4-dimethyl-1-[[2-(propylamino)-3-pyridinyl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 3,4-dimethyl-1-[[2-(propylamino)-3-pyridinyl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 79181550 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 3,4-dimethyl-1-[[2-(propylamino)-3-pyridinyl]methyl]pyrrolidine-2,5-dione |
| SMILES | CCCNc1ncccc1CN1C(=O)C(C)C(C)C1=O |
| InChI | InChI=1S/C15H21N3O2/c1-4-7-16-13-12(6-5-8-17-13)9-18-14(19)10(2)11(3)15(18)20/h5-6,8,10-11H,4,7,9H2,1-3H3,(H,16,17) |
| InChIKey | CUSHHIQFMCVFML-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|