C13H17N3OS — CID 79181657
6-(3,4-dimethylpyrrolidine-1-carbonyl)pyridine-3-carbothioamide (PubChem CID 79181657) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 6-(3,4-dimethylpyrrolidine-1-carbonyl)pyridine-3-carbothioamide.
| Compound Name | 6-(3,4-dimethylpyrrolidine-1-carbonyl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 79181657 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 6-(3,4-dimethylpyrrolidine-1-carbonyl)pyridine-3-carbothioamide |
| SMILES | CC1CN(C(=O)c2ccc(C(N)=S)cn2)CC1C |
| InChI | InChI=1S/C13H17N3OS/c1-8-6-16(7-9(8)2)13(17)11-4-3-10(5-15-11)12(14)18/h3-5,8-9H,6-7H2,1-2H3,(H2,14,18) |
| InChIKey | WOOTZTANGJWDDR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|