About 1-[(4-methoxypyrrolidin-2-yl)methyl]-3,4-dimethylpyrrolidine
1-[(4-methoxypyrrolidin-2-yl)methyl]-3,4-dimethylpyrrolidine (PubChem CID 79181758) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 1-[(4-methoxypyrrolidin-2-yl)methyl]-3,4-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 1-[(4-methoxypyrrolidin-2-yl)methyl]-3,4-dimethylpyrrolidine |
| PubChem CID | 79181758 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 1-[(4-methoxypyrrolidin-2-yl)methyl]-3,4-dimethylpyrrolidine |
| SMILES | COC1CNC(CN2CC(C)C(C)C2)C1 |
| InChI | InChI=1S/C12H24N2O/c1-9-6-14(7-10(9)2)8-11-4-12(15-3)5-13-11/h9-13H,4-8H2,1-3H3 |
| InChIKey | VEXXHYDASJFRGW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4-methoxypyrrolidin-2-yl)methyl]-3,4-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methoxypyrrolidin-2-yl)methyl]-3,4-dimethylpyrrolidine?
The IUPAC name of 1-[(4-methoxypyrrolidin-2-yl)methyl]-3,4-dimethylpyrrolidine (CID 79181758) is 1-[(4-methoxypyrrolidin-2-yl)methyl]-3,4-dimethylpyrrolidine.
What is the SMILES notation for 1-[(4-methoxypyrrolidin-2-yl)methyl]-3,4-dimethylpyrrolidine?
The canonical SMILES for 1-[(4-methoxypyrrolidin-2-yl)methyl]-3,4-dimethylpyrrolidine is COC1CNC(CN2CC(C)C(C)C2)C1.
What is the InChIKey of 1-[(4-methoxypyrrolidin-2-yl)methyl]-3,4-dimethylpyrrolidine?
The InChIKey is VEXXHYDASJFRGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O/c1-9-6-14(7-10(9)2)8-11-4-12(15-3)5-13-11/h9-13H,4-8H2,1-3H3.
What are the key properties of 1-[(4-methoxypyrrolidin-2-yl)methyl]-3,4-dimethylpyrrolidine?
1-[(4-methoxypyrrolidin-2-yl)methyl]-3,4-dimethylpyrrolidine has a molecular weight of 212.34 g/mol, XLogP of 0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methoxypyrrolidin-2-yl)methyl]-3,4-dimethylpyrrolidine is sourced from PubChem (CID 79181758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).