C10H15N3O2 — CID 79182107
1-[(4-methylmorpholin-2-yl)methyl]imidazole-2-carbaldehyde (PubChem CID 79182107) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 1-[(4-methylmorpholin-2-yl)methyl]imidazole-2-carbaldehyde.
| Compound Name | 1-[(4-methylmorpholin-2-yl)methyl]imidazole-2-carbaldehyde |
|---|---|
| PubChem CID | 79182107 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-[(4-methylmorpholin-2-yl)methyl]imidazole-2-carbaldehyde |
| SMILES | CN1CCOC(Cn2ccnc2C=O)C1 |
| InChI | InChI=1S/C10H15N3O2/c1-12-4-5-15-9(6-12)7-13-3-2-11-10(13)8-14/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | VXXKLBXRXJREEJ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|