C11H17BN2O4 — CID 79182686
[5-[(4-methylmorpholin-2-yl)methoxy]-3-pyridinyl]boronic acid (PubChem CID 79182686) has the molecular formula C11H17BN2O4 and a molecular weight of 252.08 g/mol. Its IUPAC name is [5-[(4-methylmorpholin-2-yl)methoxy]-3-pyridinyl]boronic acid.
| Compound Name | [5-[(4-methylmorpholin-2-yl)methoxy]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 79182686 |
| Molecular Formula | C11H17BN2O4 |
| Molecular Weight | 252.08 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | [5-[(4-methylmorpholin-2-yl)methoxy]-3-pyridinyl]boronic acid |
| SMILES | CN1CCOC(COc2cncc(B(O)O)c2)C1 |
| InChI | InChI=1S/C11H17BN2O4/c1-14-2-3-17-11(7-14)8-18-10-4-9(12(15)16)5-13-6-10/h4-6,11,15-16H,2-3,7-8H2,1H3 |
| InChIKey | MJDOFIFTHCVDKK-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 75.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.08 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|