C16H21NO3 — CID 79183075
4-[3-[(4-methylmorpholin-2-yl)methoxy]phenyl]but-3-yn-1-ol (PubChem CID 79183075) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-[3-[(4-methylmorpholin-2-yl)methoxy]phenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-[(4-methylmorpholin-2-yl)methoxy]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 79183075 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 4-[3-[(4-methylmorpholin-2-yl)methoxy]phenyl]but-3-yn-1-ol |
| SMILES | CN1CCOC(COc2cccc(C#CCCO)c2)C1 |
| InChI | InChI=1S/C16H21NO3/c1-17-8-10-19-16(12-17)13-20-15-7-4-6-14(11-15)5-2-3-9-18/h4,6-7,11,16,18H,3,8-10,12-13H2,1H3 |
| InChIKey | CCLYPHYHMPGTNK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|