About 3-chloro-N'-(2-thiophen-3-ylacetyl)benzohydrazide
3-chloro-N'-(2-thiophen-3-ylacetyl)benzohydrazide (PubChem CID 7918359) has the molecular formula C13H11ClN2O2S
and a molecular weight of 294.76 g/mol. Its IUPAC name is 3-chloro-N'-(2-thiophen-3-ylacetyl)benzohydrazide.
Molecular Properties
| Compound Name | 3-chloro-N'-(2-thiophen-3-ylacetyl)benzohydrazide |
| PubChem CID | 7918359 |
| Molecular Formula | C13H11ClN2O2S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 3-chloro-N'-(2-thiophen-3-ylacetyl)benzohydrazide |
| SMILES | O=C(Cc1ccsc1)NNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H11ClN2O2S/c14-11-3-1-2-10(7-11)13(18)16-15-12(17)6-9-4-5-19-8-9/h1-5,7-8H,6H2,(H,15,17)(H,16,18) |
| InChIKey | GGBXRVHWRPYPQY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N'-(2-thiophen-3-ylacetyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N'-(2-thiophen-3-ylacetyl)benzohydrazide?
The IUPAC name of 3-chloro-N'-(2-thiophen-3-ylacetyl)benzohydrazide (CID 7918359) is 3-chloro-N'-(2-thiophen-3-ylacetyl)benzohydrazide.
What is the SMILES notation for 3-chloro-N'-(2-thiophen-3-ylacetyl)benzohydrazide?
The canonical SMILES for 3-chloro-N'-(2-thiophen-3-ylacetyl)benzohydrazide is O=C(Cc1ccsc1)NNC(=O)c1cccc(Cl)c1.
What is the InChIKey of 3-chloro-N'-(2-thiophen-3-ylacetyl)benzohydrazide?
The InChIKey is GGBXRVHWRPYPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN2O2S/c14-11-3-1-2-10(7-11)13(18)16-15-12(17)6-9-4-5-19-8-9/h1-5,7-8H,6H2,(H,15,17)(H,16,18).
What are the key properties of 3-chloro-N'-(2-thiophen-3-ylacetyl)benzohydrazide?
3-chloro-N'-(2-thiophen-3-ylacetyl)benzohydrazide has a molecular weight of 294.76 g/mol, XLogP of 2.41, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N'-(2-thiophen-3-ylacetyl)benzohydrazide is sourced from PubChem (CID 7918359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).