About 4-[(3,4-dimethylpyrrolidin-1-yl)methyl]oxane-4-carbaldehyde
4-[(3,4-dimethylpyrrolidin-1-yl)methyl]oxane-4-carbaldehyde (PubChem CID 79183741) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is 4-[(3,4-dimethylpyrrolidin-1-yl)methyl]oxane-4-carbaldehyde.
Molecular Properties
| Compound Name | 4-[(3,4-dimethylpyrrolidin-1-yl)methyl]oxane-4-carbaldehyde |
| PubChem CID | 79183741 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 4-[(3,4-dimethylpyrrolidin-1-yl)methyl]oxane-4-carbaldehyde |
| SMILES | CC1CN(CC2(C=O)CCOCC2)CC1C |
| InChI | InChI=1S/C13H23NO2/c1-11-7-14(8-12(11)2)9-13(10-15)3-5-16-6-4-13/h10-12H,3-9H2,1-2H3 |
| InChIKey | SYJLMHSGLFLBHO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,4-dimethylpyrrolidin-1-yl)methyl]oxane-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-dimethylpyrrolidin-1-yl)methyl]oxane-4-carbaldehyde?
The IUPAC name of 4-[(3,4-dimethylpyrrolidin-1-yl)methyl]oxane-4-carbaldehyde (CID 79183741) is 4-[(3,4-dimethylpyrrolidin-1-yl)methyl]oxane-4-carbaldehyde.
What is the SMILES notation for 4-[(3,4-dimethylpyrrolidin-1-yl)methyl]oxane-4-carbaldehyde?
The canonical SMILES for 4-[(3,4-dimethylpyrrolidin-1-yl)methyl]oxane-4-carbaldehyde is CC1CN(CC2(C=O)CCOCC2)CC1C.
What is the InChIKey of 4-[(3,4-dimethylpyrrolidin-1-yl)methyl]oxane-4-carbaldehyde?
The InChIKey is SYJLMHSGLFLBHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-11-7-14(8-12(11)2)9-13(10-15)3-5-16-6-4-13/h10-12H,3-9H2,1-2H3.
What are the key properties of 4-[(3,4-dimethylpyrrolidin-1-yl)methyl]oxane-4-carbaldehyde?
4-[(3,4-dimethylpyrrolidin-1-yl)methyl]oxane-4-carbaldehyde has a molecular weight of 225.33 g/mol, XLogP of 1.57, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-dimethylpyrrolidin-1-yl)methyl]oxane-4-carbaldehyde is sourced from PubChem (CID 79183741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).