About [1-[(3,4-dimethylpyrrolidin-1-yl)methyl]cyclohexyl]methanol
[1-[(3,4-dimethylpyrrolidin-1-yl)methyl]cyclohexyl]methanol (PubChem CID 79183947) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is [1-[(3,4-dimethylpyrrolidin-1-yl)methyl]cyclohexyl]methanol.
Molecular Properties
| Compound Name | [1-[(3,4-dimethylpyrrolidin-1-yl)methyl]cyclohexyl]methanol |
| PubChem CID | 79183947 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | [1-[(3,4-dimethylpyrrolidin-1-yl)methyl]cyclohexyl]methanol |
| SMILES | CC1CN(CC2(CO)CCCCC2)CC1C |
| InChI | InChI=1S/C14H27NO/c1-12-8-15(9-13(12)2)10-14(11-16)6-4-3-5-7-14/h12-13,16H,3-11H2,1-2H3 |
| InChIKey | ACYKGIVNXGCVFK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-[(3,4-dimethylpyrrolidin-1-yl)methyl]cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(3,4-dimethylpyrrolidin-1-yl)methyl]cyclohexyl]methanol?
The IUPAC name of [1-[(3,4-dimethylpyrrolidin-1-yl)methyl]cyclohexyl]methanol (CID 79183947) is [1-[(3,4-dimethylpyrrolidin-1-yl)methyl]cyclohexyl]methanol.
What is the SMILES notation for [1-[(3,4-dimethylpyrrolidin-1-yl)methyl]cyclohexyl]methanol?
The canonical SMILES for [1-[(3,4-dimethylpyrrolidin-1-yl)methyl]cyclohexyl]methanol is CC1CN(CC2(CO)CCCCC2)CC1C.
What is the InChIKey of [1-[(3,4-dimethylpyrrolidin-1-yl)methyl]cyclohexyl]methanol?
The InChIKey is ACYKGIVNXGCVFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO/c1-12-8-15(9-13(12)2)10-14(11-16)6-4-3-5-7-14/h12-13,16H,3-11H2,1-2H3.
What are the key properties of [1-[(3,4-dimethylpyrrolidin-1-yl)methyl]cyclohexyl]methanol?
[1-[(3,4-dimethylpyrrolidin-1-yl)methyl]cyclohexyl]methanol has a molecular weight of 225.38 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(3,4-dimethylpyrrolidin-1-yl)methyl]cyclohexyl]methanol is sourced from PubChem (CID 79183947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).