About 1-[3-(chloromethyl)-2,4-difluorophenyl]sulfonyl-3,4-dimethylpyrrolidine
1-[3-(chloromethyl)-2,4-difluorophenyl]sulfonyl-3,4-dimethylpyrrolidine (PubChem CID 79184739) has the molecular formula C13H16ClF2NO2S
and a molecular weight of 323.79 g/mol. Its IUPAC name is 1-[3-(chloromethyl)-2,4-difluorophenyl]sulfonyl-3,4-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 1-[3-(chloromethyl)-2,4-difluorophenyl]sulfonyl-3,4-dimethylpyrrolidine |
| PubChem CID | 79184739 |
| Molecular Formula | C13H16ClF2NO2S |
| Molecular Weight | 323.79 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-[3-(chloromethyl)-2,4-difluorophenyl]sulfonyl-3,4-dimethylpyrrolidine |
| SMILES | CC1CN(S(=O)(=O)c2ccc(F)c(CCl)c2F)CC1C |
| InChI | InChI=1S/C13H16ClF2NO2S/c1-8-6-17(7-9(8)2)20(18,19)12-4-3-11(15)10(5-14)13(12)16/h3-4,8-9H,5-7H2,1-2H3 |
| InChIKey | KFTKDQBMDWZUSV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.79 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(chloromethyl)-2,4-difluorophenyl]sulfonyl-3,4-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(chloromethyl)-2,4-difluorophenyl]sulfonyl-3,4-dimethylpyrrolidine?
The IUPAC name of 1-[3-(chloromethyl)-2,4-difluorophenyl]sulfonyl-3,4-dimethylpyrrolidine (CID 79184739) is 1-[3-(chloromethyl)-2,4-difluorophenyl]sulfonyl-3,4-dimethylpyrrolidine.
What is the SMILES notation for 1-[3-(chloromethyl)-2,4-difluorophenyl]sulfonyl-3,4-dimethylpyrrolidine?
The canonical SMILES for 1-[3-(chloromethyl)-2,4-difluorophenyl]sulfonyl-3,4-dimethylpyrrolidine is CC1CN(S(=O)(=O)c2ccc(F)c(CCl)c2F)CC1C.
What is the InChIKey of 1-[3-(chloromethyl)-2,4-difluorophenyl]sulfonyl-3,4-dimethylpyrrolidine?
The InChIKey is KFTKDQBMDWZUSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClF2NO2S/c1-8-6-17(7-9(8)2)20(18,19)12-4-3-11(15)10(5-14)13(12)16/h3-4,8-9H,5-7H2,1-2H3.
What are the key properties of 1-[3-(chloromethyl)-2,4-difluorophenyl]sulfonyl-3,4-dimethylpyrrolidine?
1-[3-(chloromethyl)-2,4-difluorophenyl]sulfonyl-3,4-dimethylpyrrolidine has a molecular weight of 323.79 g/mol, XLogP of 2.98, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(chloromethyl)-2,4-difluorophenyl]sulfonyl-3,4-dimethylpyrrolidine is sourced from PubChem (CID 79184739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).