C13H28N2 — CID 79185962
2-N,2-N-diethyl-3-N,2,5-trimethylhex-5-ene-2,3-diamine (PubChem CID 79185962) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 2-N,2-N-diethyl-3-N,2,5-trimethylhex-5-ene-2,3-diamine.
| Compound Name | 2-N,2-N-diethyl-3-N,2,5-trimethylhex-5-ene-2,3-diamine |
|---|---|
| PubChem CID | 79185962 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 2-N,2-N-diethyl-3-N,2,5-trimethylhex-5-ene-2,3-diamine |
| SMILES | C=C(C)CC(NC)C(C)(C)N(CC)CC |
| InChI | InChI=1S/C13H28N2/c1-8-15(9-2)13(5,6)12(14-7)10-11(3)4/h12,14H,3,8-10H2,1-2,4-7H3 |
| InChIKey | GEEHXZFAARKUNS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|