C14H30N2 — CID 79186071
2-N,2-N,3-N-triethyl-2,5-dimethylhex-5-ene-2,3-diamine (PubChem CID 79186071) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 2-N,2-N,3-N-triethyl-2,5-dimethylhex-5-ene-2,3-diamine.
| Compound Name | 2-N,2-N,3-N-triethyl-2,5-dimethylhex-5-ene-2,3-diamine |
|---|---|
| PubChem CID | 79186071 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 2-N,2-N,3-N-triethyl-2,5-dimethylhex-5-ene-2,3-diamine |
| SMILES | C=C(C)CC(NCC)C(C)(C)N(CC)CC |
| InChI | InChI=1S/C14H30N2/c1-8-15-13(11-12(4)5)14(6,7)16(9-2)10-3/h13,15H,4,8-11H2,1-3,5-7H3 |
| InChIKey | XDZMVHLHTYRMTB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|