C13H16FNO4S — CID 79187207
3-fluoro-4-(3-methylpiperidin-1-yl)sulfonylbenzoic acid (PubChem CID 79187207) has the molecular formula C13H16FNO4S and a molecular weight of 301.34 g/mol. Its IUPAC name is 3-fluoro-4-(3-methylpiperidin-1-yl)sulfonylbenzoic acid.
| Compound Name | 3-fluoro-4-(3-methylpiperidin-1-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 79187207 |
| Molecular Formula | C13H16FNO4S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 3-fluoro-4-(3-methylpiperidin-1-yl)sulfonylbenzoic acid |
| SMILES | CC1CCCN(S(=O)(=O)c2ccc(C(=O)O)cc2F)C1 |
| InChI | InChI=1S/C13H16FNO4S/c1-9-3-2-6-15(8-9)20(18,19)12-5-4-10(13(16)17)7-11(12)14/h4-5,7,9H,2-3,6,8H2,1H3,(H,16,17) |
| InChIKey | SLKFAUKONAARKG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |