About 5-(3,4-dimethylpyrrolidin-1-yl)-3-methyl-5-oxopentanoic acid
5-(3,4-dimethylpyrrolidin-1-yl)-3-methyl-5-oxopentanoic acid (PubChem CID 79187870) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is 5-(3,4-dimethylpyrrolidin-1-yl)-3-methyl-5-oxopentanoic acid.
Analyze 5-(3,4-dimethylpyrrolidin-1-yl)-3-methyl-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethylpyrrolidin-1-yl)-3-methyl-5-oxopentanoic acid?
The IUPAC name of 5-(3,4-dimethylpyrrolidin-1-yl)-3-methyl-5-oxopentanoic acid (CID 79187870) is 5-(3,4-dimethylpyrrolidin-1-yl)-3-methyl-5-oxopentanoic acid.
What is the SMILES notation for 5-(3,4-dimethylpyrrolidin-1-yl)-3-methyl-5-oxopentanoic acid?
The canonical SMILES for 5-(3,4-dimethylpyrrolidin-1-yl)-3-methyl-5-oxopentanoic acid is CC(CC(=O)O)CC(=O)N1CC(C)C(C)C1.
What is the InChIKey of 5-(3,4-dimethylpyrrolidin-1-yl)-3-methyl-5-oxopentanoic acid?
The InChIKey is FAXVZGVKPDLBNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c1-8(5-12(15)16)4-11(14)13-6-9(2)10(3)7-13/h8-10H,4-7H2,1-3H3,(H,15,16).
What are the key properties of 5-(3,4-dimethylpyrrolidin-1-yl)-3-methyl-5-oxopentanoic acid?
5-(3,4-dimethylpyrrolidin-1-yl)-3-methyl-5-oxopentanoic acid has a molecular weight of 227.30 g/mol, XLogP of 1.60, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethylpyrrolidin-1-yl)-3-methyl-5-oxopentanoic acid is sourced from PubChem (CID 79187870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).