About 2-(3,4-dimethylpyrrolidin-1-yl)-4,4-dimethylpentan-1-amine
2-(3,4-dimethylpyrrolidin-1-yl)-4,4-dimethylpentan-1-amine (PubChem CID 79188396) has the molecular formula C13H28N2
and a molecular weight of 212.38 g/mol. Its IUPAC name is 2-(3,4-dimethylpyrrolidin-1-yl)-4,4-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 2-(3,4-dimethylpyrrolidin-1-yl)-4,4-dimethylpentan-1-amine |
| PubChem CID | 79188396 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 2-(3,4-dimethylpyrrolidin-1-yl)-4,4-dimethylpentan-1-amine |
| SMILES | CC1CN(C(CN)CC(C)(C)C)CC1C |
| InChI | InChI=1S/C13H28N2/c1-10-8-15(9-11(10)2)12(7-14)6-13(3,4)5/h10-12H,6-9,14H2,1-5H3 |
| InChIKey | BMSPBBAYUTUVJJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,4-dimethylpyrrolidin-1-yl)-4,4-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethylpyrrolidin-1-yl)-4,4-dimethylpentan-1-amine?
The IUPAC name of 2-(3,4-dimethylpyrrolidin-1-yl)-4,4-dimethylpentan-1-amine (CID 79188396) is 2-(3,4-dimethylpyrrolidin-1-yl)-4,4-dimethylpentan-1-amine.
What is the SMILES notation for 2-(3,4-dimethylpyrrolidin-1-yl)-4,4-dimethylpentan-1-amine?
The canonical SMILES for 2-(3,4-dimethylpyrrolidin-1-yl)-4,4-dimethylpentan-1-amine is CC1CN(C(CN)CC(C)(C)C)CC1C.
What is the InChIKey of 2-(3,4-dimethylpyrrolidin-1-yl)-4,4-dimethylpentan-1-amine?
The InChIKey is BMSPBBAYUTUVJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2/c1-10-8-15(9-11(10)2)12(7-14)6-13(3,4)5/h10-12H,6-9,14H2,1-5H3.
What are the key properties of 2-(3,4-dimethylpyrrolidin-1-yl)-4,4-dimethylpentan-1-amine?
2-(3,4-dimethylpyrrolidin-1-yl)-4,4-dimethylpentan-1-amine has a molecular weight of 212.38 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylpyrrolidin-1-yl)-4,4-dimethylpentan-1-amine is sourced from PubChem (CID 79188396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).