C14H18INO — CID 79188459
2-(3,4-dimethylpyrrolidin-1-yl)-1-(4-iodophenyl)ethanone (PubChem CID 79188459) has the molecular formula C14H18INO and a molecular weight of 343.21 g/mol. Its IUPAC name is 2-(3,4-dimethylpyrrolidin-1-yl)-1-(4-iodophenyl)ethanone.
| Compound Name | 2-(3,4-dimethylpyrrolidin-1-yl)-1-(4-iodophenyl)ethanone |
|---|---|
| PubChem CID | 79188459 |
| Molecular Formula | C14H18INO |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 2-(3,4-dimethylpyrrolidin-1-yl)-1-(4-iodophenyl)ethanone |
| SMILES | CC1CN(CC(=O)c2ccc(I)cc2)CC1C |
| InChI | InChI=1S/C14H18INO/c1-10-7-16(8-11(10)2)9-14(17)12-3-5-13(15)6-4-12/h3-6,10-11H,7-9H2,1-2H3 |
| InChIKey | MOXTYPUEPRBDPH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|