About 1-[2-(3,4-dimethylpyrrolidin-1-yl)-5-fluorophenyl]-N-methylethanamine
1-[2-(3,4-dimethylpyrrolidin-1-yl)-5-fluorophenyl]-N-methylethanamine (PubChem CID 79188631) has the molecular formula C15H23FN2
and a molecular weight of 250.36 g/mol. Its IUPAC name is 1-[2-(3,4-dimethylpyrrolidin-1-yl)-5-fluorophenyl]-N-methylethanamine.
Molecular Properties
| Compound Name | 1-[2-(3,4-dimethylpyrrolidin-1-yl)-5-fluorophenyl]-N-methylethanamine |
| PubChem CID | 79188631 |
| Molecular Formula | C15H23FN2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 1-[2-(3,4-dimethylpyrrolidin-1-yl)-5-fluorophenyl]-N-methylethanamine |
| SMILES | CNC(C)c1cc(F)ccc1N1CC(C)C(C)C1 |
| InChI | InChI=1S/C15H23FN2/c1-10-8-18(9-11(10)2)15-6-5-13(16)7-14(15)12(3)17-4/h5-7,10-12,17H,8-9H2,1-4H3 |
| InChIKey | PWBCMFNLXZUWMK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-(3,4-dimethylpyrrolidin-1-yl)-5-fluorophenyl]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,4-dimethylpyrrolidin-1-yl)-5-fluorophenyl]-N-methylethanamine?
The IUPAC name of 1-[2-(3,4-dimethylpyrrolidin-1-yl)-5-fluorophenyl]-N-methylethanamine (CID 79188631) is 1-[2-(3,4-dimethylpyrrolidin-1-yl)-5-fluorophenyl]-N-methylethanamine.
What is the SMILES notation for 1-[2-(3,4-dimethylpyrrolidin-1-yl)-5-fluorophenyl]-N-methylethanamine?
The canonical SMILES for 1-[2-(3,4-dimethylpyrrolidin-1-yl)-5-fluorophenyl]-N-methylethanamine is CNC(C)c1cc(F)ccc1N1CC(C)C(C)C1.
What is the InChIKey of 1-[2-(3,4-dimethylpyrrolidin-1-yl)-5-fluorophenyl]-N-methylethanamine?
The InChIKey is PWBCMFNLXZUWMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23FN2/c1-10-8-18(9-11(10)2)15-6-5-13(16)7-14(15)12(3)17-4/h5-7,10-12,17H,8-9H2,1-4H3.
What are the key properties of 1-[2-(3,4-dimethylpyrrolidin-1-yl)-5-fluorophenyl]-N-methylethanamine?
1-[2-(3,4-dimethylpyrrolidin-1-yl)-5-fluorophenyl]-N-methylethanamine has a molecular weight of 250.36 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,4-dimethylpyrrolidin-1-yl)-5-fluorophenyl]-N-methylethanamine is sourced from PubChem (CID 79188631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).