About 1-[2-(1,3-dioxan-2-yl)ethyl]-3,4-dimethylpyrrolidine
1-[2-(1,3-dioxan-2-yl)ethyl]-3,4-dimethylpyrrolidine (PubChem CID 79189022) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-[2-(1,3-dioxan-2-yl)ethyl]-3,4-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 1-[2-(1,3-dioxan-2-yl)ethyl]-3,4-dimethylpyrrolidine |
| PubChem CID | 79189022 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 1-[2-(1,3-dioxan-2-yl)ethyl]-3,4-dimethylpyrrolidine |
| SMILES | CC1CN(CCC2OCCCO2)CC1C |
| InChI | InChI=1S/C12H23NO2/c1-10-8-13(9-11(10)2)5-4-12-14-6-3-7-15-12/h10-12H,3-9H2,1-2H3 |
| InChIKey | SRGMUBOGENQPMJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(1,3-dioxan-2-yl)ethyl]-3,4-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,3-dioxan-2-yl)ethyl]-3,4-dimethylpyrrolidine?
The IUPAC name of 1-[2-(1,3-dioxan-2-yl)ethyl]-3,4-dimethylpyrrolidine (CID 79189022) is 1-[2-(1,3-dioxan-2-yl)ethyl]-3,4-dimethylpyrrolidine.
What is the SMILES notation for 1-[2-(1,3-dioxan-2-yl)ethyl]-3,4-dimethylpyrrolidine?
The canonical SMILES for 1-[2-(1,3-dioxan-2-yl)ethyl]-3,4-dimethylpyrrolidine is CC1CN(CCC2OCCCO2)CC1C.
What is the InChIKey of 1-[2-(1,3-dioxan-2-yl)ethyl]-3,4-dimethylpyrrolidine?
The InChIKey is SRGMUBOGENQPMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-10-8-13(9-11(10)2)5-4-12-14-6-3-7-15-12/h10-12H,3-9H2,1-2H3.
What are the key properties of 1-[2-(1,3-dioxan-2-yl)ethyl]-3,4-dimethylpyrrolidine?
1-[2-(1,3-dioxan-2-yl)ethyl]-3,4-dimethylpyrrolidine has a molecular weight of 213.32 g/mol, XLogP of 1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,3-dioxan-2-yl)ethyl]-3,4-dimethylpyrrolidine is sourced from PubChem (CID 79189022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).