About 1-methoxy-N,4-dimethylpent-3-en-2-amine
1-methoxy-N,4-dimethylpent-3-en-2-amine (PubChem CID 79189746) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 1-methoxy-N,4-dimethylpent-3-en-2-amine.
Molecular Properties
| Compound Name | 1-methoxy-N,4-dimethylpent-3-en-2-amine |
| PubChem CID | 79189746 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 1-methoxy-N,4-dimethylpent-3-en-2-amine |
| SMILES | CNC(C=C(C)C)COC |
| InChI | InChI=1S/C8H17NO/c1-7(2)5-8(9-3)6-10-4/h5,8-9H,6H2,1-4H3 |
| InChIKey | DGBGKRJNPOQGKG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-N,4-dimethylpent-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-N,4-dimethylpent-3-en-2-amine?
The IUPAC name of 1-methoxy-N,4-dimethylpent-3-en-2-amine (CID 79189746) is 1-methoxy-N,4-dimethylpent-3-en-2-amine.
What is the SMILES notation for 1-methoxy-N,4-dimethylpent-3-en-2-amine?
The canonical SMILES for 1-methoxy-N,4-dimethylpent-3-en-2-amine is CNC(C=C(C)C)COC.
What is the InChIKey of 1-methoxy-N,4-dimethylpent-3-en-2-amine?
The InChIKey is DGBGKRJNPOQGKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-7(2)5-8(9-3)6-10-4/h5,8-9H,6H2,1-4H3.
What are the key properties of 1-methoxy-N,4-dimethylpent-3-en-2-amine?
1-methoxy-N,4-dimethylpent-3-en-2-amine has a molecular weight of 143.23 g/mol, XLogP of 1.19, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-N,4-dimethylpent-3-en-2-amine is sourced from PubChem (CID 79189746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).