C14H14N2O4S — CID 79191303
4-[(5-cyano-2-methylphenyl)sulfonylamino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79191303) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is 4-[(5-cyano-2-methylphenyl)sulfonylamino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[(5-cyano-2-methylphenyl)sulfonylamino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79191303 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-[(5-cyano-2-methylphenyl)sulfonylamino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | Cc1ccc(C#N)cc1S(=O)(=O)NC1C=CC(C(=O)O)C1 |
| InChI | InChI=1S/C14H14N2O4S/c1-9-2-3-10(8-15)6-13(9)21(19,20)16-12-5-4-11(7-12)14(17)18/h2-6,11-12,16H,7H2,1H3,(H,17,18) |
| InChIKey | GGSQBOCITWEYSO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|