C16H26N2O3 — CID 79191671
4-[(4-ethylcyclohexyl)methylcarbamoylamino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79191671) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 4-[(4-ethylcyclohexyl)methylcarbamoylamino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[(4-ethylcyclohexyl)methylcarbamoylamino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79191671 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 4-[(4-ethylcyclohexyl)methylcarbamoylamino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | CCC1CCC(CNC(=O)NC2C=CC(C(=O)O)C2)CC1 |
| InChI | InChI=1S/C16H26N2O3/c1-2-11-3-5-12(6-4-11)10-17-16(21)18-14-8-7-13(9-14)15(19)20/h7-8,11-14H,2-6,9-10H2,1H3,(H,19,20)(H2,17,18,21) |
| InChIKey | UDYIRQFTZFCQLG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|