C11H16N2O2 — CID 79191742
4-hydroxy-N-(4-methyl-3-pyridinyl)pentanamide (PubChem CID 79191742) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-hydroxy-N-(4-methyl-3-pyridinyl)pentanamide.
| Compound Name | 4-hydroxy-N-(4-methyl-3-pyridinyl)pentanamide |
|---|---|
| PubChem CID | 79191742 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 4-hydroxy-N-(4-methyl-3-pyridinyl)pentanamide |
| SMILES | Cc1ccncc1NC(=O)CCC(C)O |
| InChI | InChI=1S/C11H16N2O2/c1-8-5-6-12-7-10(8)13-11(15)4-3-9(2)14/h5-7,9,14H,3-4H2,1-2H3,(H,13,15) |
| InChIKey | JHGVIGNGKIGZEW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |