C15H17NO5 — CID 79191926
4-[(2,6-dimethoxybenzoyl)amino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79191926) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 4-[(2,6-dimethoxybenzoyl)amino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[(2,6-dimethoxybenzoyl)amino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79191926 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 4-[(2,6-dimethoxybenzoyl)amino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | COc1cccc(OC)c1C(=O)NC1C=CC(C(=O)O)C1 |
| InChI | InChI=1S/C15H17NO5/c1-20-11-4-3-5-12(21-2)13(11)14(17)16-10-7-6-9(8-10)15(18)19/h3-7,9-10H,8H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | XRLCDKQTDVRECI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|