About 4-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid
4-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79192070) has the molecular formula C14H12N2O3S2
and a molecular weight of 320.40 g/mol. Its IUPAC name is 4-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid |
| PubChem CID | 79192070 |
| Molecular Formula | C14H12N2O3S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 4-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | O=C(NC1C=CC(C(=O)O)C1)c1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C14H12N2O3S2/c17-12(15-10-2-1-8(5-10)14(18)19)11-7-21-13(16-11)9-3-4-20-6-9/h1-4,6-8,10H,5H2,(H,15,17)(H,18,19) |
| InChIKey | NUXKEHKORFLZDF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid?
The IUPAC name of 4-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid (CID 79192070) is 4-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid.
What is the SMILES notation for 4-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid?
The canonical SMILES for 4-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid is O=C(NC1C=CC(C(=O)O)C1)c1csc(-c2ccsc2)n1.
What is the InChIKey of 4-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid?
The InChIKey is NUXKEHKORFLZDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O3S2/c17-12(15-10-2-1-8(5-10)14(18)19)11-7-21-13(16-11)9-3-4-20-6-9/h1-4,6-8,10H,5H2,(H,15,17)(H,18,19).
What are the key properties of 4-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid?
4-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid has a molecular weight of 320.40 g/mol, XLogP of 2.63, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]cyclopent-2-ene-1-carboxylic acid is sourced from PubChem (CID 79192070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).