About 4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]butan-1-ol
4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]butan-1-ol (PubChem CID 79193177) has the molecular formula C10H12N2O3
and a molecular weight of 208.22 g/mol. Its IUPAC name is 4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]butan-1-ol.
Molecular Properties
| Compound Name | 4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]butan-1-ol |
| PubChem CID | 79193177 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]butan-1-ol |
| SMILES | OCCCCc1nc(-c2ccco2)no1 |
| InChI | InChI=1S/C10H12N2O3/c13-6-2-1-5-9-11-10(12-15-9)8-4-3-7-14-8/h3-4,7,13H,1-2,5-6H2 |
| InChIKey | MJJIMMBKBOSETM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]butan-1-ol?
The IUPAC name of 4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]butan-1-ol (CID 79193177) is 4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]butan-1-ol.
What is the SMILES notation for 4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]butan-1-ol?
The canonical SMILES for 4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]butan-1-ol is OCCCCc1nc(-c2ccco2)no1.
What is the InChIKey of 4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]butan-1-ol?
The InChIKey is MJJIMMBKBOSETM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O3/c13-6-2-1-5-9-11-10(12-15-9)8-4-3-7-14-8/h3-4,7,13H,1-2,5-6H2.
What are the key properties of 4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]butan-1-ol?
4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]butan-1-ol has a molecular weight of 208.22 g/mol, XLogP of 1.64, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]butan-1-ol is sourced from PubChem (CID 79193177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).