About N-cyano-4,5-dimethylthiophene-2-carboxamide
N-cyano-4,5-dimethylthiophene-2-carboxamide (PubChem CID 79194270) has the molecular formula C8H8N2OS
and a molecular weight of 180.23 g/mol. Its IUPAC name is N-cyano-4,5-dimethylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-cyano-4,5-dimethylthiophene-2-carboxamide |
| PubChem CID | 79194270 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | N-cyano-4,5-dimethylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NC#N)sc1C |
| InChI | InChI=1S/C8H8N2OS/c1-5-3-7(12-6(5)2)8(11)10-4-9/h3H,1-2H3,(H,10,11) |
| InChIKey | NBXCXXNRFMBMOY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze N-cyano-4,5-dimethylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyano-4,5-dimethylthiophene-2-carboxamide?
The IUPAC name of N-cyano-4,5-dimethylthiophene-2-carboxamide (CID 79194270) is N-cyano-4,5-dimethylthiophene-2-carboxamide.
What is the SMILES notation for N-cyano-4,5-dimethylthiophene-2-carboxamide?
The canonical SMILES for N-cyano-4,5-dimethylthiophene-2-carboxamide is Cc1cc(C(=O)NC#N)sc1C.
What is the InChIKey of N-cyano-4,5-dimethylthiophene-2-carboxamide?
The InChIKey is NBXCXXNRFMBMOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2OS/c1-5-3-7(12-6(5)2)8(11)10-4-9/h3H,1-2H3,(H,10,11).
What are the key properties of N-cyano-4,5-dimethylthiophene-2-carboxamide?
N-cyano-4,5-dimethylthiophene-2-carboxamide has a molecular weight of 180.23 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyano-4,5-dimethylthiophene-2-carboxamide is sourced from PubChem (CID 79194270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).