C12H14N2O2 — CID 79194357
N-cyano-3-(2,5-dimethylphenoxy)propanamide (PubChem CID 79194357) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is N-cyano-3-(2,5-dimethylphenoxy)propanamide.
| Compound Name | N-cyano-3-(2,5-dimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 79194357 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N-cyano-3-(2,5-dimethylphenoxy)propanamide |
| SMILES | Cc1ccc(C)c(OCCC(=O)NC#N)c1 |
| InChI | InChI=1S/C12H14N2O2/c1-9-3-4-10(2)11(7-9)16-6-5-12(15)14-8-13/h3-4,7H,5-6H2,1-2H3,(H,14,15) |
| InChIKey | QZVDRBNPCHHNKS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|