About N-cyano-2,4,6-trimethylbenzamide
N-cyano-2,4,6-trimethylbenzamide (PubChem CID 79194591) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is N-cyano-2,4,6-trimethylbenzamide.
Molecular Properties
| Compound Name | N-cyano-2,4,6-trimethylbenzamide |
| PubChem CID | 79194591 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | N-cyano-2,4,6-trimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)NC#N)c(C)c1 |
| InChI | InChI=1S/C11H12N2O/c1-7-4-8(2)10(9(3)5-7)11(14)13-6-12/h4-5H,1-3H3,(H,13,14) |
| InChIKey | XCPCRFBNVKSITI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze N-cyano-2,4,6-trimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyano-2,4,6-trimethylbenzamide?
The IUPAC name of N-cyano-2,4,6-trimethylbenzamide (CID 79194591) is N-cyano-2,4,6-trimethylbenzamide.
What is the SMILES notation for N-cyano-2,4,6-trimethylbenzamide?
The canonical SMILES for N-cyano-2,4,6-trimethylbenzamide is Cc1cc(C)c(C(=O)NC#N)c(C)c1.
What is the InChIKey of N-cyano-2,4,6-trimethylbenzamide?
The InChIKey is XCPCRFBNVKSITI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-7-4-8(2)10(9(3)5-7)11(14)13-6-12/h4-5H,1-3H3,(H,13,14).
What are the key properties of N-cyano-2,4,6-trimethylbenzamide?
N-cyano-2,4,6-trimethylbenzamide has a molecular weight of 188.23 g/mol, XLogP of 1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyano-2,4,6-trimethylbenzamide is sourced from PubChem (CID 79194591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).