About N-cyano-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide
N-cyano-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 79194682) has the molecular formula C9H12N4O3
and a molecular weight of 224.22 g/mol. Its IUPAC name is N-cyano-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide.
Molecular Properties
| Compound Name | N-cyano-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
| PubChem CID | 79194682 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | N-cyano-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | CN1CC(=O)N(CCCC(=O)NC#N)C1=O |
| InChI | InChI=1S/C9H12N4O3/c1-12-5-8(15)13(9(12)16)4-2-3-7(14)11-6-10/h2-5H2,1H3,(H,11,14) |
| InChIKey | HWXNAJKRHFNNQJ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze N-cyano-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyano-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide?
The IUPAC name of N-cyano-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide (CID 79194682) is N-cyano-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide.
What is the SMILES notation for N-cyano-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide?
The canonical SMILES for N-cyano-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide is CN1CC(=O)N(CCCC(=O)NC#N)C1=O.
What is the InChIKey of N-cyano-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide?
The InChIKey is HWXNAJKRHFNNQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O3/c1-12-5-8(15)13(9(12)16)4-2-3-7(14)11-6-10/h2-5H2,1H3,(H,11,14).
What are the key properties of N-cyano-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide?
N-cyano-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide has a molecular weight of 224.22 g/mol, XLogP of -0.74, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyano-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide is sourced from PubChem (CID 79194682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).