C10H7N3O3 — CID 79194815
N-cyano-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide (PubChem CID 79194815) has the molecular formula C10H7N3O3 and a molecular weight of 217.18 g/mol. Its IUPAC name is N-cyano-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide.
| Compound Name | N-cyano-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 79194815 |
| Molecular Formula | C10H7N3O3 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | N-cyano-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide |
| SMILES | N#CNC(=O)Cn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C10H7N3O3/c11-6-12-9(14)5-13-7-3-1-2-4-8(7)16-10(13)15/h1-4H,5H2,(H,12,14) |
| InChIKey | RNYYMCGXQQSQLD-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|