C12H10F3N — CID 79195348
5,6,7-trifluoro-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 79195348) has the molecular formula C12H10F3N and a molecular weight of 225.21 g/mol. Its IUPAC name is 5,6,7-trifluoro-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 5,6,7-trifluoro-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 79195348 |
| Molecular Formula | C12H10F3N |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 5,6,7-trifluoro-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | Fc1cc2[nH]c3c(c2c(F)c1F)CCCC3 |
| InChI | InChI=1S/C12H10F3N/c13-7-5-9-10(12(15)11(7)14)6-3-1-2-4-8(6)16-9/h5,16H,1-4H2 |
| InChIKey | BQFZGPIBJDTUFK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|